| Identification | |
| Name: | 1H-1,4-Diazepine,1-[(4-chlorophenyl)phenylmethyl]hexahydro-4-methyl- |
| CAS: | 848-53-3 |
| EINECS: | 212-699-1 |
| Molecular Formula: | C19H23 Cl N2 |
| Molecular Weight: | 314.89 |
| InChI: | InChI=1/C19H23ClN2/c1-21-12-5-13-22(15-14-21)19(16-6-3-2-4-7-16)17-8-10-18(20)11-9-17/h2-4,6-11,19H,5,12-15H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.122 g/cm3 |
| Refractive index: | 1.58 |
| Specification: |
Homochlorcyclizine , its cas register number is 848-53-3. It also can be called N-(p-Chlorobenzhydryl)-N'-methylhomopiperazine ; 1-(p-Chloro-alpha-phenylbenzyl)hexahydro-4-methyl-1H-1,4-diazepine ; and 1H-1,4-Diazepine, 1-(p-chloro-alpha-phenylbenzyl)hexahydro-4-methyl- (8CI) . |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
 |
|
