| Identification | |
| Name: | 1H-Indole,4-(1-piperazinyl)- |
| Synonyms: | 1-(1H-Indol-4-yl)piperazine;1-(4-Indolyl)piperazine; 4-(Piperazin-1-yl)-1H-indole; 4-(Piperazino)indole |
| CAS: | 84807-09-0 |
| Molecular Formula: | C12H15 N3 |
| Molecular Weight: | 201.27 |
| InChI: | InChI=1/C12H15N3/c1-2-11-10(4-5-14-11)12(3-1)15-8-6-13-7-9-15/h1-5,13-14H,6-9H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.182 g/cm3 |
| Refractive index: | 1.65 |
| Specification: | Brown Solid Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Safety Data | |
 |
|
