Identification |
Name: | methyl 4-amino-3-phenylbutanoate |
Synonyms: | Methyl ester of phenigama;Butyric acid, 4-amino-3-phenyl-, methyl ester;beta-(Aminomethyl)hydrocinnamic acid methyl ester;HYDROCINNAMIC ACID, beta-(AMINOMETHYL)-, METHYL ESTER;AC1L1ISX;methyl 4-amino-3-phenylbutanoate;LS-77140;84872-79-7 |
CAS: | 84872-79-7 |
Molecular Formula: | C11H15NO2 |
Molecular Weight: | 193.2423 |
InChI: | InChI=1/C11H15NO2/c1-14-11(13)7-10(8-12)9-5-3-2-4-6-9/h2-6,10H,7-8,12H2,1H3 |
Molecular Structure: |
![(C11H15NO2) Methyl ester of phenigama;Butyric acid, 4-amino-3-phenyl-, methyl ester;beta-(Aminomethyl)hydrocinna...](https://img.guidechem.com/pic/image/84872-79-7.png) |
Properties |
Flash Point: | 152.7°C |
Boiling Point: | 296.5°C at 760 mmHg |
Density: | 1.075g/cm3 |
Refractive index: | 1.524 |
Flash Point: | 152.7°C |
Safety Data |
|
![](/images/detail_15.png) |