Identification |
Name: | 1,3,5-triazine-2,4,6(1H,3H,5H)-trione compound with 1,3,5-triazine-2,4,6(1H,3H,5H)-trione trihydrazone (1:1) |
Synonyms: | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione compound with 1,3,5-triazine-2,4,6(1H,3H,5H)-trione trihydrazone (1:1);1,3,5-triazinane-2,4,6-trione; 1,3,5-triazinane-2,4,6-trione hydrazone |
CAS: | 84946-02-1 |
EINECS: | 284-604-1 |
Molecular Formula: | C6H12N12O3 |
Molecular Weight: | 300.2381 |
InChI: | InChI=1/C3H9N9.C3H3N3O3/c4-10-1-7-2(11-5)9-3(8-1)12-6;7-1-4-2(8)6-3(9)5-1/h4-6H2,(H3,7,8,9,10,11,12);(H3,4,5,6,7,8,9) |
Molecular Structure: |
![(C6H12N12O3) 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione compound with 1,3,5-triazine-2,4,6(1H,3H,5H)-trione trihydrazo...](https://img.guidechem.com/pic/image/84946-02-1.gif) |
Properties |
Flash Point: | 286.7°C |
Boiling Point: | 550.5°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 286.7°C |
Safety Data |
|
![](/images/detail_15.png) |