| Identification | |
| Name: | 8-Chlorotheophylline |
| Synonyms: | 8-Chloro-1,3-dimethyl-2,6(1H,3H)-purinedione; 8-Chloro-1,3-dimethyl-2,6-purinedione |
| CAS: | 85-18-7 |
| EINECS: | 201-590-4 |
| Molecular Formula: | C7H7ClN4O2 |
| Molecular Weight: | 214.61 |
| InChI: | InChI=1/C7H7ClN4O2/c1-11-4-3(9-6(8)10-4)5(13)12(2)7(11)14/h1-2H3,(H,9,10) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Flash Point: | 229 ºC |
| Boiling Point: | 455 ºC at 760 mmHg |
| Density: | 1.591 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.631 |
| Water Solubility: | SLIGHTLY SOLUBLE |
| Solubility: | SLIGHTLY SOLUBLE |
| Appearance: | White powder. |
| Specification: |
8-Chlorotheophylline , its cas register number is 85-18-7. It also can be called 1,3-Dimethyl-8-chloroxanthine ; 8-Chloro-3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione ; EINECS 201-590-4 ; NSC 6113 ; 1H-Purine-2,6-dione, 8-chloro-3,7-dihydro-1,3-dimethyl-(9CI) ; Theophylline, 8-chloro- .It is a white to light yellow crystal powder.And it is a stimulant drug of the xanthine chemical class. Also it is combined with pharmaceutical drugs to form stable salts, such as dimenhydrinate. |
| Packinggroup: | III |
| Flash Point: | 229 ºC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
