InChI: | InChI=1/C12H16BNO3/c15-12(14-11-6-1-2-7-11)9-4-3-5-10(8-9)13(16)17/h3-5,8,11,16-17H,1-2,6-7H2,(H,14,15) |
Specification: |
The CAS register number of 3-(Cyclopentylaminocarbonyl)phenylboronic acid is 850567-24-7. It also can be called as Boronic acid,B-[3-[(cyclopentylamino)carbonyl]phenyl]- and the systematic name about this chemical is [3-(cyclopentylcarbamoyl)phenyl]boronic acid. The molecular formula about this chemical is C12H16BNO3 and the molecular weight is 233.07. It belongs to the following product categories, such as Blocks; BoronicAcids and so on.
Physical properties about 3-(Cyclopentylaminocarbonyl)phenylboronic acid are: (1)ACD/LogP: 1.73; (2)#H bond acceptors: 4; (3)#H bond donors: 3; (4)#Freely Rotating Bonds: 5; (5)Polar Surface Area: 38.77Å2; (6)Index of Refraction: 1.567; (7)Molar Refractivity: 62.77 cm3; (8)Molar Volume: 191.8 cm3; (9)Polarizability: 24.88x10-24cm3; (10)Surface Tension: 50.7 dyne/cm.
You can still convert the following datas into molecular structure:
(1)SMILES: O=C(c1cccc(B(O)O)c1)NC2CCCC2
(2)InChI: InChI=1/C12H16BNO3/c15-12(14-11-6-1-2-7-11)9-4-3-5-10(8-9)13(16)17/h3-5,8,11,16-17H,1-2,6-7H2,(H,14,15)
(3)InChIKey: KIOBFDGZJVJNBP-UHFFFAOYAL
(4)Std. InChI: InChI=1S/C12H16BNO3/c15-12(14-11-6-1-2-7-11)9-4-3-5-10(8-9)13(16)17/h3-5,8,11,16-17H,1-2,6-7H2,(H,14,15)
(5)Std. InChIKey: KIOBFDGZJVJNBP-UHFFFAOYSA-N
|