| Identification | |
| Name: | Methanone,(2,5-difluorophenyl)phenyl- |
| Synonyms: | 2,5-Difluorobenzophenone |
| CAS: | 85068-36-6 |
| EINECS: | 285-298-2 |
| Molecular Formula: | C13H8 F2 O |
| Molecular Weight: | 218.2 |
| InChI: | InChI=1/C13H8F2O/c14-10-6-7-12(15)11(8-10)13(16)9-4-2-1-3-5-9/h1-8H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | >110°C |
| Boiling Point: | 120 °C |
| Density: | 1.262 |
| Refractive index: | 1.5693 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | >110°C |
| Safety Data | |
 |
|
