Identification |
Name: | 2-thenoic acid, compound with 2-aminoethanol (1:1) |
Synonyms: | 2-Thenoic acid, compound with 2-aminoethanol (1:1);2-aminoethanol; thiophene-2-carboxylic acid |
CAS: | 85068-50-4 |
EINECS: | 285-310-6 |
Molecular Formula: | C7H11NO3S |
Molecular Weight: | 189.2321 |
InChI: | InChI=1/C5H4O2S.C2H7NO/c6-5(7)4-2-1-3-8-4;3-1-2-4/h1-3H,(H,6,7);4H,1-3H2 |
Molecular Structure: |
![(C7H11NO3S) 2-Thenoic acid, compound with 2-aminoethanol (1:1);2-aminoethanol; thiophene-2-carboxylic acid](https://img.guidechem.com/pic/image/85068-50-4.gif) |
Properties |
Flash Point: | 212.7°C |
Boiling Point: | 428°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 212.7°C |
Safety Data |
|
![](/images/detail_15.png) |