Identification |
Name: | Ethanone,1-(3,4-dihydro-2H-pyrrol-5-yl)- |
Synonyms: | 2-Acetyl-1-pyrroline;2-Acetyl-4,5-dihydro-3H-pyrrole; |
CAS: | 85213-22-5 |
Molecular Formula: | C6H9NO |
Molecular Weight: | 111.14176 |
InChI: | InChI=1S/C6H9NO/c1-5(8)6-3-2-4-7-6/h2-4H2,1H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 66.2 °C |
Boiling Point: | 182.9 °C at 760 mmHg |
Density: | 1.09 g/cm3 |
Flash Point: | 66.2 °C |
Usage: | It is isolated from rice and identified as the compound responsible for the flavor and aroma of scented rice after cooking. |
Safety Data |
|
 |