| Identification | |
| Name: | 4-Bromo-2,5-dimethylphenol |
| Synonyms: | phenol, 4-bromo-2,5-dimethyl-;TL80073466;4-Bromo-2,5-dimethylphenol 98%; |
| CAS: | 85223-93-4 |
| Molecular Formula: | C8H9BrO |
| Molecular Weight: | 201.06 |
| InChI: | InChI=1/C8H9BrO/c1-5-4-8(10)6(2)3-7(5)9/h3-4,10H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.471 g/cm3 |
| Refractive index: | 1.58 |
| Specification: |
The 4-Bromo-2,5-dimethylphenol with the cas number 85223-93-4, is also called phenol, 4-bromo-2,5-dimethyl- .This chemical belongs to the following product categories:(1)blocks; (2)Bromides. The properties of this chemical are: (1)#H bond acceptors: 1 ; (2)#H bond donors: 1 ; (3)#Freely Rotating Bonds: 1 ; (4)Polar Surface Area: 20.23 Å2 ; (5)Index of Refraction: 1.58 ; (6)Molar Refractivity: 45.47 cm3 ; (7)Molar Volume: 136.5 cm3 ; (8)Polarizability: 18.02×10-24cm3 ; (9)Surface Tension: 42.1 dyne/cm ; (10)Enthalpy of Vaporization: 51.67 kJ/mol ; (11)Vapour Pressure: 0.00821 mmHg at 25°C . This product can be supplied by the following suppliers: (1)Wuhan Chemwish Technology Co., Ltd.; (2)B&S Group (Asia) Ltd.; (3)ABCR GmbH KG; (4)APAC Pharmaceutical, LLC; (5)Ambinter; (6)American Custom Chemicals Corp.; (7)Apollo Scientific Ltd.; (8)Eurolabs Limited; (9)Otava Ltd.; (10)Hexagon Labs. You can still convert the following datas into molecular structure : |
| Safety Data | |
 |
|
