| Identification | |
| Name: | (+)-AJ 76 HYDROCHLORIDE |
| CAS: | 85379-09-5 |
| Molecular Formula: | C15H24ClNO |
| Molecular Weight: | 269.81 |
| InChI: | InChI=1/C15H23NO/c1-4-10-16-14-9-8-13-12(11(14)2)6-5-7-15(13)17-3/h5-7,11,14,16H,4,8-10H2,1-3H3/t11-,14+/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 145.9°C |
| Boiling Point: | 345.3°C at 760 mmHg |
| Density: | 1g/cm3 |
| Refractive index: | 1.526 |
| Biological Activity: | Dopamine receptor antagonist with preferential action at presynaptic receptors (pK i values are 6.95, 6.67, 6.37, 6.21 and 6.07 at hD 3 . hD 4 , hD 2S , hD 2L and rD 2 receptors respectively). |
| Flash Point: | 145.9°C |
| Storage Temperature: | Store at RT |
| Safety Data | |
 |
|
