Identification |
Name: | 4-Heptenoic acid,7-[(1R,2R,3S,5S)-5-([1,1'-biphenyl]-4-ylmethoxy)-3-hydroxy-2-(1-piperidinyl)cyclopentyl]-,(4Z)- |
Synonyms: | 4-Heptenoicacid, 7-[5-([1,1'-biphenyl]-4-ylmethoxy)-3-hydroxy-2-(1-piperidinyl)cyclopentyl]-,[1R-[1a(Z),2b,3b,5a]]-; GR 32191; GR 322191;Vapiprost |
CAS: | 85505-64-2 |
Molecular Formula: | C30H39 N O4 |
Molecular Weight: | 514.1 |
InChI: | InChI=1/C30H39NO4/c32-27-21-28(35-22-23-15-17-25(18-16-23)24-11-5-3-6-12-24)26(13-7-1-2-8-14-29(33)34)30(27)31-19-9-4-10-20-31/h1-3,5-6,11-12,15-18,26-28,30,32H,4,7-10,13-14,19-22H2,(H,33,34)/b2-1-/t26-,27-,28-,30+/m0/s1 |
Molecular Structure: |
![(C30H39NO4) 4-Heptenoicacid, 7-[5-([1,1'-biphenyl]-4-ylmethoxy)-3-hydroxy-2-(1-piperidinyl)cyclopentyl]-,[1R-[1a...](https://img1.guidechem.com/chem/e/dict/1/85505-64-2.jpg) |
Properties |
Melting Point: | 127-128 °C
|
Flash Point: | 346.5°C |
Boiling Point: | 649.3°C at 760 mmHg |
Density: | 1.18g/cm3 |
Refractive index: | 1.605 |
Biological Activity: | Potent thromboxane A 2 (TP) receptor antagonist. Inhibits platelet aggregation (pA 2 ~ 8.3) and relaxes vascular and airway smooth muscle (pA 2 = 7.9-10.3). |
Flash Point: | 346.5°C |
Storage Temperature: | −20°C |
Color: | off-white |
Safety Data |
|
 |