| Identification | |
| Synonyms: | 4,4'-(1,2-Diethylethylene)diresorcinol |
| CAS: | 85720-47-4 |
| Molecular Formula: | C18H22O4 |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C18H22O4/c1-3-13(15-7-5-11(19)9-17(15)21)14(4-2)16-8-6-12(20)10-18(16)22/h5-10,13-14,19-22H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 234.5°C |
| Boiling Point: | 501°Cat760mmHg |
| Density: | 1.238g/cm3 |
| Specification: |
4,4′-(1,2-Diethylethylene)diresorcinol , with CAS number of 85720-47-4, can be called 4-[1-ethyl-2-(2,4-dihydroxyphenyl)butyl]-3-hydroxyphenol ; 4-[2-(2,4-dihydroxyphenyl)-1-ethylbutyl]-1,3-benzenediol ; Resorcinol, 4,4'-(1,2-diethylethylene)di- and so on. |
| Report: |
4,4′-(1,2-Diethylethylene)diresorcinol (CAS NO. 85720-47-4) was reported in JMCMAR Journal of Medicinal Chemistry. |
| Flash Point: | 234.5°C |
| Safety Data | |
 |
|
