Identification |
Name: | 2-Butenedioic acid(2Z)-, monobutyl ester, ester with 1,2-propanediol (1:1) (9CI) |
Synonyms: | 2-Butenedioicacid (Z)-, monobutyl ester, ester with 1,2-propanediol (1:1) |
CAS: | 85909-47-3 |
EINECS: | 288-851-6 |
Molecular Formula: | C11H18 O5 |
Molecular Weight: | 230.25762 |
InChI: | InChI=1/C11H18O5/c1-2-3-8-15-10(13)5-6-11(14)16-9-4-7-12/h5-6,12H,2-4,7-9H2,1H3/b6-5- |
Molecular Structure: |
![(C11H18O5) 2-Butenedioicacid (Z)-, monobutyl ester, ester with 1,2-propanediol (1:1)](https://img1.guidechem.com/chem/e/dict/43/85909-47-3.jpg) |
Properties |
Flash Point: | 130.6°C |
Boiling Point: | 353.9°C at 760 mmHg |
Density: | 1.105g/cm3 |
Refractive index: | 1.47 |
Flash Point: | 130.6°C |
Safety Data |
|
![](/images/detail_15.png) |