| Identification | |
| Name: | 1-Hydroxy-2-naphthoic acid |
| Synonyms: | 1-Naphthol-2-carboxylic acid; 2-Naphthalenecarboxylic acid, 1-hydroxy- |
| CAS: | 86-48-6 |
| EINECS: | 201-674-0 |
| Molecular Formula: | C11H8O3 |
| Molecular Weight: | 188.18 |
| InChI: | InChI=1/C11H8O3/c12-10-8-4-2-1-3-7(8)5-6-9(10)11(13)14/h1-6,12H,(H,13,14) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.399 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | SOLUBLE IN HOT WATER |
| Solubility: | SOLUBLE IN HOT WATER |
| Appearance: | White Powder |
| Specification: |
1-Hydroxy-2-naphthoic acid , its CAS NO. is 86-48-6, the synonyms are 1-hydroxy-2-naphthalenecarboxylicaci ;1-hydroxy-2-Naphthalenecarboxylicacid |
| HS Code: | 29182910 |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
