| Identification | |
| Name: | 1-(Chloromethyl)naphthalene |
| Synonyms: | 1-Naphthylmethyl chloride; 1-(CHLOROMETHYL)-NAPHTHALENE; 1-CMN; a-Naphthylmethyl Chloride; 1-Chloromethyl naphthalene |
| CAS: | 86-52-2 |
| EINECS: | 201-678-2 |
| Molecular Formula: | C11H9Cl |
| Molecular Weight: | 176.64 |
| InChI: | InChI=1/C11H9Cl/c12-8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7H,8H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 8 |
| Density: | 1.17 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.635-1.639 |
| Solubility: | Insoluble |
| Appearance: | Solid |
| Specification: |
? 1-Chloromethyl naphthalene , with CAS number of 86-52-2, can be called 1-(Chloromethyl)naphthalene ; 1-Naphthalenylmethyl chloride ; 1-Naphthylmethylchloride ; a-Naphthylmethyl chloride . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29036990 |
| Storage Temperature: | Refrigerator |
| Sensitive: | Moisture Sensitive |
| Color: | deep brown |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
