Identification |
Name: | 1-(Chloromethyl)naphthalene |
Synonyms: | 1-Naphthylmethyl chloride; 1-(CHLOROMETHYL)-NAPHTHALENE; 1-CMN; a-Naphthylmethyl Chloride; 1-Chloromethyl naphthalene |
CAS: | 86-52-2 |
EINECS: | 201-678-2 |
Molecular Formula: | C11H9Cl |
Molecular Weight: | 176.64 |
InChI: | InChI=1/C11H9Cl/c12-8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7H,8H2 |
Molecular Structure: |
 |
Properties |
Transport: | UN 3261 8 |
Density: | 1.17 |
Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
Refractive index: | 1.635-1.639 |
Solubility: | Insoluble |
Appearance: | Solid |
Specification: |
? 1-Chloromethyl naphthalene , with CAS number of 86-52-2, can be called 1-(Chloromethyl)naphthalene ; 1-Naphthalenylmethyl chloride ; 1-Naphthylmethylchloride ; a-Naphthylmethyl chloride .
|
Report: |
Reported in EPA TSCA Inventory.
|
Packinggroup: | III |
HS Code: | 29036990 |
Storage Temperature: | Refrigerator |
Sensitive: | Moisture Sensitive |
Color: | deep brown |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
 |