| Identification | |
| Name: | 4,7-Dichloroquinoline |
| Synonyms: | 4,7-Dichloroquinone |
| CAS: | 86-98-6 |
| EINECS: | 201-714-7 |
| Molecular Formula: | C9H5Cl2N |
| Molecular Weight: | 198.05 |
| InChI: | InChI=1/C9H5Cl2N/c10-6-1-2-7-8(11)3-4-12-9(7)5-6/h1-5H |
| Molecular Structure: |  |
| Properties | |
| Transport: | HAZARD |
| Density: | 1.407 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.66 |
| Water Solubility: | insoluble |
| Solubility: | Insoluble |
| Appearance: | yellow to brown crystals |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29334910 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
