| Identification | |
| Name: | 2,5-Methanopentalen-3a(1H)-amine,hexahydro-, hydrochloride (1:1) |
| Synonyms: | 2,5-Methanopentalen-3a(1H)-amine,hexahydro-, hydrochloride (9CI) |
| CAS: | 86128-83-8 |
| Molecular Formula: | C9H15 N . Cl H |
| Molecular Weight: | 173.68 |
| InChI: | InChI=1/C9H15N.ClH/c10-9-4-6-1-7(5-9)3-8(9)2-6;/h6-8H,1-5,10H2;1H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 350 °C |
| Flash Point: | 97.3°C |
| Boiling Point: | 237.3°C at 760 mmHg |
| Specification: | Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 97.3°C |
| Safety Data | |
 |
|
