| Identification | |
| Name: | 1H-Indazole-4-carbonitrile |
| Synonyms: | 4-Indazolenitrile(2CI); |
| CAS: | 861340-10-5 |
| Molecular Formula: | C8H5N3 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C8H5N3/c9-4-6-2-1-3-8-7(6)5-10-11-8/h1-3,5H,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.33 g/cm3 |
| Refractive index: | 1.684 |
| Specification: |
The 4-Cyano-1H-indazole, with the CAS registry number 861340-10-5, has the systematic name and IUPAC name of 1H-indazole-4-carbonitrile. The molecular formula of the chemical is C8H5N3. And it belongs to the product categories of Building Blocks and Indazole. The characteristics of this chemical are as followings: (1)ACD/LogP: 1.26; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.26; (4)ACD/LogD (pH 7.4): 1.26; (5)#H bond acceptors: 3; (6)#H bond donors: 1; (7)#Freely Rotating Bonds: 0; (8)Polar Surface Area: 52.47 Å2; (9)Index of Refraction: 1.684; (10)Molar Refractivity: 40.6 cm3; (11)Molar Volume: 106.8 cm3; (12)Polarizability: 16.09×10-24cm3; (13)Surface Tension: 75.3 dyne/cm; (14)Density: 1.33 g/cm3; (15)Flash Point: 126.7 °C; (16)Enthalpy of Vaporization: 61.72 kJ/mol; (17)Boiling Point: 370.3 °C at 760 mmHg; (18)Vapour Pressure: 1.12E-05 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
