| Identification | |
| Name: | 2-Propenamide,N-(2-chloro-6-methylphenyl)-3-ethoxy-, (2E)- |
| Synonyms: | (E)-N-(2-Chloro-6-methylphenyl)-3-ethoxyacrylamide;(2E)-N-(2-Chloro-6-methylphenyl)-3-ethoxy-2-propenamide; |
| CAS: | 863127-76-8 |
| Molecular Formula: | C12H14ClNO2 |
| Molecular Weight: | 239.7 |
| InChI: | InChI=1/C12H14ClNO2/c1-3-16-8-7-11(15)14-12-9(2)5-4-6-10(12)13/h4-8H,3H2,1-2H3,(H,14,15)/b8-7+ |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.197 |
| Refractive index: | 1.572 |
| Specification: |
The (E)-N-(2-Chloro-6-methylphenyl)-3-ethoxyacrylamide with the CAS number 863127-76-8 is also called (2E)-N-(2-Chloro-6-methylphenyl)-3-ethoxy-2-propenamide. The systematic name is 2-propenamide, N-(2-chloro-6-methylphenyl)-3-ethoxy-, (2E)-. Its molecular formula is C12H14ClNO2. The properties of the chemical are: (1)ACD/LogP: 3.04; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3.04; (4)ACD/LogD (pH 7.4): 3.04; (5)ACD/BCF (pH 5.5): 120.64; (6)ACD/BCF (pH 7.4): 120.63; (7)ACD/KOC (pH 5.5): 1075.3; (8)ACD/KOC (pH 7.4): 1075.23; (9)#H bond acceptors: 3; (10)#H bond donors: 1; (11)#Freely Rotating Bonds: 4; (12)Polar Surface Area: 38.33 Å2; (13)Index of Refraction: 1.572; (14)Molar Refractivity: 65.94 cm3; (15)Molar Volume: 200.2 cm3; (16)Polarizability: 26.14×10-24cm3; (17)Surface Tension: 42.3 dyne/cm; (18)Enthalpy of Vaporization: 63.55 kJ/mol; (19)Vapour Pressure: 3.51E-06 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
