| Identification | |
| Name: | Benzoyl chloride,2,4-dichloro-5-fluoro- |
| Synonyms: | 2,4-Dichloro-5-fluorobenzoylchloride |
| CAS: | 86393-34-2 |
| EINECS: | 428-390-1 |
| Molecular Formula: | C7H2 Cl3 F O |
| Molecular Weight: | 227.45 |
| InChI: | InChI=1/C7H2Cl3FO/c8-4-2-5(9)6(11)1-3(4)7(10)12/h1-2H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 |
| Density: | 1.568 |
| Refractive index: | 1.572 |
| Appearance: | Colorless to pale yellow liquid |
| Specification: |
1. Personal Protection: Wear appropriate protective gloves, clothing and goggles. |
| Packinggroup: | II |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
