Identification |
Name: | 2H-1-Benzopyran-2-one,5,7-dimethoxy-3-(1-naphthalenylcarbonyl)- |
Synonyms: | 5,7-Dimethoxy-3-(1-naphthoyl)coumarin;NSC 379523 |
CAS: | 86548-40-5 |
Molecular Formula: | C22H16 O5 |
Molecular Weight: | 360.3594 |
InChI: | InChI=1/C22H16O5/c1-25-14-10-19(26-2)17-12-18(22(24)27-20(17)11-14)21(23)16-9-5-7-13-6-3-4-8-15(13)16/h3-12H,1-2H3 |
Molecular Structure: |
 |
Properties |
Melting Point: | 209-212 °C |
Flash Point: | 353°C |
Boiling Point: | 606.2°Cat760mmHg |
Density: | 1.314g/cm3 |
Refractive index: | 1.654 |
Specification: | yellow crystalline powder usageEng:Coumarin derivatives are involved in photogeneration of reactive oxygen species from ketocoumarins. Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
Flash Point: | 353°C |
Usage: | Coumarin derivatives are involved in photogeneration of reactive oxygen species from ketocoumarins. |
Safety Data |
|
 |