| Identification | |
| Name: | URB754 |
| Synonyms: | URB754;6-Methyl-2-[(4-methylphenyl)amino]-4H-3,1-benzoxazin-4-one;6-Methyl-2-[(4-methylphenyl)amino]-4H-3,1-benzoxazine-4-one |
| CAS: | 86672-58-4 |
| Molecular Formula: | C16H14 N2 O2 |
| Molecular Weight: | 266.29 |
| InChI: | InChI=1/C16H14N2O2/c1-10-3-6-12(7-4-10)17-16-18-14-8-5-11(2)9-13(14)15(19)20-16/h3-9H,1-2H3,(H,17,18) |
| Molecular Structure: | ![(C16H14N2O2) URB754;6-Methyl-2-[(4-methylphenyl)amino]-4H-3,1-benzoxazin-4-one;6-Methyl-2-[(4-methylphenyl)amino...](https://img1.guidechem.com/chem/e/dict/4/86672-58-4.jpg) |
| Properties | |
| Density: | 1.23g/cm3 |
| Refractive index: | 1.627 |
| Appearance: | off-white solid |
| Usage: | URB754 is a potent, noncompetitive inhibitor of MGL, exhibiting an IC50 of 200 nM for the recombinant rat brain enzyme. It inhibits rat brain fatty acyl amide hydrolase (FAAH) less effectively with an IC50 of 32 and binds weakly to the rat CB1 r |
| Safety Data | |
 |
|
