Identification |
Name: | Glycerolformal |
Synonyms: | Glycerol formal |
CAS: | 86687-05-0 |
EINECS: | 225-248-9 |
Molecular Formula: | C4H8O3 |
Molecular Weight: | 104.11 |
InChI: | InChI=1/C3H8O3.C3H8O2/c4-1-3(6)2-5;1-4-3-5-2/h3-6H,1-2H2;3H2,1-2H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 170 °F |
Boiling Point: | 192-193 °C(lit.) |
Density: | 1.203 g/mL at 25 °C(lit.) |
Refractive index: | n20/D 1.451(lit.) |
Specification: | Safety Statements:23-24/25 23:Do not breathe gas/fumes/vapor/spray (appropriate wording
to be specified by the manufacturer) 24/25:Avoid contact with skin and eyes |
Flash Point: | 170 °F |
Safety Data |
|
 |