| Identification | |
| Name: | Glycerolformal |
| Synonyms: | Glycerol formal |
| CAS: | 86687-05-0 |
| EINECS: | 225-248-9 |
| Molecular Formula: | C4H8O3 |
| Molecular Weight: | 104.11 |
| InChI: | InChI=1/C3H8O3.C3H8O2/c4-1-3(6)2-5;1-4-3-5-2/h3-6H,1-2H2;3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 170 °F |
| Boiling Point: | 192-193 °C(lit.) |
| Density: | 1.203 g/mL at 25 °C(lit.) |
| Refractive index: | n20/D 1.451(lit.) |
| Specification: | Safety Statements:23-24/25 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 24/25:Avoid contact with skin and eyes |
| Flash Point: | 170 °F |
| Safety Data | |
 |
|
