| Identification |
| Name: | Benzene,1-nitro-4-(nonyloxy)- |
| Synonyms: | 4-Nitrophenylnonyl ether |
| CAS: | 86702-46-7 |
| Molecular Formula: | C15H23 N O3 |
| Molecular Weight: | 265.348 |
| InChI: | InChI=1/C15H23NO3/c1-2-3-4-5-6-7-8-13-19-15-11-9-14(10-12-15)16(17)18/h9-12H,2-8,13H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 143.7°C |
| Boiling Point: | 380.7°Cat760mmHg |
| Density: | 1.031g/cm3 |
| Stability: | Stable. Incompatible with strong bases, strong oxidizing agents. |
| Refractive index: | n20/D 1.525(lit.) |
| Water Solubility: | Stability Stable. Incompatible with strong bases, strong oxidizing agents. Toxicology May be harmful or act as an irritant - toxicology not fully investigated. Toxicity data |
| Solubility: | |
| Flash Point: | 143.7°C |
| Safety Data |
| |
 |
