| Identification | |
| Name: | dimethyl bromomalonate |
| Synonyms: | Dimethyl 2-bromomalonate;Propanedioic acid, bromo-, dimethyl ester;DIMETHYL BROMOMALONATE;DIMETHYL BROMOMALONATE, TECH., 90%;Dimethyl bromomalonate ,98%;Dimethyl bromomalonate, 90%, tech.;2-Bromomalonic acid dimethyl ester;Bromomalonic acid dimethyl ester |
| CAS: | 868-26-8 |
| EINECS: | 212-775-4 |
| Molecular Formula: | C5H7BrO4 |
| Molecular Weight: | 211.011 |
| InChI: | InChI=1S/C5H7BrO4/c1-9-4(7)3(6)5(8)10-2/h3H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 8/PG 2 |
| Flash Point: | >230 °F |
| Boiling Point: | 105-108 °C11 mm Hg(lit.) |
| Density: | 1.601 g/mL at 25 °C(lit.) |
| Refractive index: | n20/D 1.460(lit.) |
| Appearance: | clear colorless to light yellow liquid |
| Specification: | clear colorless to light yellow liquid Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | III |
| Flash Point: | >230 °F |
| Safety Data | |
 |
|
