| Identification | |
| Name: | 1-Chloromethyl-1,2-ethanediol diacetate |
| Synonyms: | 1,2-Diacetoxy-3-chloropropane;3-Chloro-1,2-diacetoxypropane |
| CAS: | 869-50-1 |
| Molecular Formula: | C7H11ClO4 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C7H11ClO4/c1-5(9)11-4-7(3-8)12-6(2)10/h7H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 99.2°C |
| Boiling Point: | 245°C at 760 mmHg |
| Density: | 1.195g/cm3 |
| Refractive index: | 1.439 |
| Specification: |
1-Chloromethyl-1,2-ethanediol diacetate with cas registry number of 869-50-1 is also known as 3-Chloro-1,2-propanediol, diacetate ; 1,2-Diacetoxy-3-chloropropane ; 1,2-Ethanediol, 1-chloromethyl-, diacetate ; 1,2-Propanediol, 3-chloro-, diacetate ; 1-Chloro-2,3-diacetoxypropane ; 1-Chloro-2,3-propanediol diacetate ; 1-Chloromethyl-1,2-ethanediol diacetate ; 3-Chloro-1,2-diacetoxypropane . It should be stored in a cool, dry place . It would emit toxic fumes such as chloride when burned . 1-Chloromethyl-1,2-ethanediol diacetate with cas registry number of 869-50-1 is used as a therapeutic agent. It is also used as a pharmaceutical intermediate. |
| Flash Point: | 99.2°C |
| Safety Data | |
 |
|
