Identification |
Name: | Acetamide,N-(4,5-dihydro-4-methyl-5-oxo-1,2-dithiolo[4,3-b]pyrrol-6-yl)- |
Synonyms: | 1,2-Dithiolo[4,3-b]pyrrol-5(4H)-one,6-acetamido-4-methyl- (6CI,7CI); 1,2-Dithiolo[4,3-b]pyrrole, acetamide deriv.;3-Acetamido-5-methylpyrrolin-4-one[4,3-d]-1,2-dithiole; Acetopyrrothin;N-(4,5-Dihydro-4-methyl-5-oxo-1,2-dithiolo[4,3-b]pyrrol-6-yl)acetamide; NSC3927; Thiolutin |
CAS: | 87-11-6 |
Molecular Formula: | C8H8 N2 O2 S2 |
Molecular Weight: | 228.30 |
InChI: | InChI=1/C8H8N2O2S2/c1-4(11)9-6-7-5(3-13-14-7)10(2)8(6)12/h3H,1-2H3,(H,9,11) |
Molecular Structure: |
![(C8H8N2O2S2) 1,2-Dithiolo[4,3-b]pyrrol-5(4H)-one,6-acetamido-4-methyl- (6CI,7CI); 1,2-Dithiolo[4,3-b]pyrrole, ace...](https://img1.guidechem.com/chem/e/dict/39/87-11-6.jpg) |
Properties |
Transport: | UN 2811 6.1/PG 2 |
Flash Point: | 243.3°C |
Boiling Point: | 478.6°C at 760 mmHg |
Density: | 1.55g/cm3 |
Refractive index: | 1.72 |
Biological Activity: | Antibiotic; inhibits bacterial RNA polymerase. Inhibits adhesion of HUVEC cells to vitronectin (IC 50 = 0.83 mM) and subsequently reduces paxillin levels. Suppresses tumor cell-induced angiogenesis. |
Flash Point: | 243.3°C |
Storage Temperature: | −20°C |
Safety Data |
Hazard Symbols |
T+: Very toxic
T: Toxic
|
|
 |