| Identification | |
| Name: | Hexachlorobutadiene |
| Synonyms: | Butadiene,hexachloro- (6CI,7CI); 1,1,2,3,4,4-Hexachloro-1,3-butadiene; C 46; HCB;Hexachloro-1,3-butadiene; Hexachlorobutadiene; NSC 3701;Perchloro-1,3-butadiene; Perchlorobutadiene |
| CAS: | 87-68-3 |
| EINECS: | 201-765-5 |
| Molecular Formula: | C4Cl6 |
| Molecular Weight: | 260.7590 |
| InChI: | InChI=1S/C4Cl6/c5-1(3(7)8)2(6)4(9)10 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2279 |
| Density: | 1.655 |
| Stability: | Stable. Incompatible with rubber, oxidizing agents. |
| Refractive index: | 1.555 |
| Solubility: | Sol in alc, ether In water, 3.20 mg/l @ 25 deg C |
| Appearance: | colourless liquid |
| Packinggroup: | III |
| Storage Temperature: | +4°C |
| Color: | Clear, colorless liquid |
| Safety Data | |
| Hazard Symbols |
T: Toxic
N: Dangerous for the environment
|
 |
|
