| Identification | |
| Name: | L(+)-Arabinose |
| Synonyms: | Arabinopyranose,L- (8CI);Pectinose;L-Arabinopyranose; |
| CAS: | 87-72-9 |
| EINECS: | 201-767-6 |
| Molecular Formula: | C5H10O5 |
| Molecular Weight: | 150.13 |
| InChI: | InChI=1/C5H10O5/c6-2-1-10-5(9)4(8)3(2)7/h2-9H,1H2/t2-,3-,4+,5?/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 155.3 oC |
| Boiling Point: | 333.2 oC at 760 mmHg |
| Density: | 1.757 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.633 |
| Alpha: | 103 o (C=5, H2O) |
| Water Solubility: | soluble |
| Solubility: | soluble in water |
| Appearance: | White to off white crystalline powder |
| Specification: |
?L(+)-Arabinose , its cas register number is 87-72-9. It also can be called?L-Arabinopyranose . It is stable under normal temperatures and pressures. And it incompatible with strong oxidizing agents. L(+)-Arabinose (CAS NO.87-72-9)?should avoid the condition of incompatible materials. Its hazardous decomposition products are carbon monoxide and carbon dioxide. Its hazardous polymerization will not occur.? |
| HS Code: | 29400000 |
| Flash Point: | 155.3 oC |
| Storage Temperature: | Store at RT. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
