Identification |
Name: | L-Sorbose |
Synonyms: | Sorbose, L-(8CI);Esorben;L-(-)-Sorbose;L-1,3,4,5,6-Pentahydroxyhexan-2-one;L-xylo-2-Hexulose;NSC 97195;Sorbose; |
CAS: | 87-79-6 |
EINECS: | 201-771-8 |
Molecular Formula: | C6H12O6 |
Molecular Weight: | 180.16 |
InChI: | InChI=1/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3,5-9,11-12H,1-2H2/t3-,5+,6+/m0/s1 |
Molecular Structure: |
 |
Properties |
Density: | 1.589 g/cm3 |
Refractive index: | -43 ° (C=1, H2O) |
Alpha: | -43 º (C=5% IN H2O) |
Water Solubility: | H2O: 0.1 g/mL, clear, colorless to very faintly yellow |
Solubility: | H2O: 0.1 g/mL, clear, colorless to very faintly yellow |
Appearance: | white to off-white crystalline powder |
Color: | RHOMBOHEDRAL CRYSTALS FROM ETHANOL Orthorhombic, bisphenoidal crystals White, crystalline powder |
Safety Data |
|
 |