| Identification | |
| Name: | Benzene,1,2,3,4,5-pentabromo-6-methyl- |
| Synonyms: | Benzene,pentabromomethyl- (9CI);Toluene, 2,3,4,5,6-pentabromo- (6CI,7CI,8CI);2,3,4,5,6-Pentabromomethylbenzene;2,3,4,5,6-Pentabromotoluene;Flammex 5BT;PBT;PBT (flame retardant);Pentabromomethylbenzene;Pentabromotoluene; |
| CAS: | 87-83-2 |
| EINECS: | 201-774-4 |
| Molecular Formula: | C7H3Br5 |
| Molecular Weight: | 486.6207 |
| InChI: | InChI=1/C7H3Br5/c1-2-3(8)5(10)7(12)6(11)4(2)9/h1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 2.607 g/cm3 |
| Stability: | Stable. |
| Refractive index: | 1.667 |
| Water Solubility: | insoluble Stability Stable. Toxicology Skin, eye and respiratory irritant. Toxicity data (The meaning of any toxicological abbreviations which appear in this sec |
| Solubility: | insoluble
|
| Appearance: | slightly yellow crystalline powder |
| Safety Data | |
 |
|
