| Identification | |
| Name: | Trichloroisocyanuric acid |
| CAS: | 87-90-1 |
| EINECS: | 201-782-8 |
| Molecular Formula: | C3Cl3N3O3 |
| Molecular Weight: | 232.41 |
| InChI: | InChI=1/C3Cl3N3O3/c4-7-1(10)8(5)3(12)9(6)2(7)11 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2468 |
| Flash Point: | 225 C |
| Density: | 2.19 g/cm3 |
| Stability: | Stable. Hygroscopic, and may decompose in contact with moisture. Contact with combustible material may lead to fire. Incompatible with acids, reducing agents, water, strong oxidizing agents. |
| Solubility: | 12 g/l SOLVENT < soluble in chlorinated and highly polar solvents |
| Appearance: | white crystalline powder or tablet (15gr - 200gr) |
| Packinggroup: | II |
| HS Code: | 29336980 |
| Flash Point: | 225 C |
| Storage Temperature: | Keep away from heat, sparks, and flame. Do not store near combustible materials. Corrosives area. Keep away from acids. Store protected from moisture. |
| Sensitive: | Hygroscopic |
| Usage: | Swimming pool sanitizer to reduce bacteria count, active ingredient in indust deodorants. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
