| Identification | |
| Name: | Boronic acid,B-(5-acetyl-2-fluorophenyl)- |
| Synonyms: | Boronicacid, (5-acetyl-2-fluorophenyl)- (9CI); (5-Acetyl-2-fluorophenyl)boronic acid;2-Fluoro-5-acetylphenylboronic acid |
| CAS: | 870777-29-0 |
| Molecular Formula: | C8H8 B F O3 |
| Molecular Weight: | 181.96 |
| InChI: | InChI=1/C8H8BFO3/c1-5(11)6-2-3-8(10)7(4-6)9(12)13/h2-4,12-13H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 112-117 °C(lit.) |
| Density: | 1.28g/cm3 |
| Refractive index: | 1.551 |
| Specification: |
2-Fluoro-5-acetylphenylboronic acid , with CAS number of 870777-29-0, can be called (5-Acetyl-2-fluorophenyl)boronic acid ; boronic acid, B-(5-acetyl-2-fluorophenyl)- ; 2-Fluoro-5-acetylphenylboronic acid ; 5-Acetyl-2-fluorobenzeneboronic acid ; 5-Acetyl-2-fluorophenylboronic acid . |
| HS Code: | 29310095 |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
