| Identification | |
| Name: | Carbamimidothioic acid,2-aminoethyl ester, hydrochloride (1:2) |
| Synonyms: | Carbamimidothioicacid, 2-aminoethyl ester, dihydrochloride (9CI); Pseudourea, 2-(2-aminoethyl)-2-thio-,dihydrochloride (8CI); F 256; Pallirad; S-b-Aminoethylpseudothiourea dihydrochloride; b-Aminoethylisothiouroniumdihydrochloride; b-Aminoethylisothiuroniumchloride hydrochloride; b-Aminoethylisothiuronium hydrochloride chloride |
| CAS: | 871-25-0 |
| Molecular Formula: | C3H9 N3 S . 2 Cl H |
| Molecular Weight: | 192.13 |
| InChI: | InChI=1/C3H9N3S.2ClH/c4-1-2-7-3(5)6;;/h1-2,4H2,(H3,5,6);2*1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 93.6°C |
| Boiling Point: | 231.1°C at 760 mmHg |
| Specification: |
2-(Aminoethyl)-isothiouronium dihydrochloride ,its cas register number is 871-25-0. It also can be called 2-(2-Aminoethyl)-2-thiopseudourea dihydrochloride ; and Pseudourea, 2-aminoethyl-2-thio-, dihydrochloride . |
| Flash Point: | 93.6°C |
| Safety Data | |
 |
|
