| Identification | |
| Name: | Thieno[3,2-d]pyrimidine-7-methanamine |
| Synonyms: | 1-(Thieno[3,2-d]pyrimidin-7-yl)methanamine;thieno[4,5-d]pyrimidin-7-ylmethanamine; |
| CAS: | 871013-29-5 |
| Molecular Formula: | C7H7N3S |
| Molecular Weight: | 165.21558 |
| InChI: | InChI=1/C7H7N3S/c8-1-5-3-11-6-2-9-4-10-7(5)6/h2-4H,1,8H2 |
| Molecular Structure: | ![(C7H7N3S) 1-(Thieno[3,2-d]pyrimidin-7-yl)methanamine;thieno[4,5-d]pyrimidin-7-ylmethanamine;](https://img1.guidechem.com/chem/e/dict/219/871013-29-5.jpg) |
| Properties | |
| Density: | 1.383 g/cm3 |
| Refractive index: | 1.718 |
| Specification: |
The Thieno[3,2-d]pyrimidin-7-ylmethanamine with the cas number 871013-29-5, is also called 1-(Thieno[3,2-d]pyrimidin-7-yl)methanamine. The product can be supplied by the following suppliers: (1)Activate Scientific GmbH; (2)Best PharmaTech, Inc.; (3)D-L Chiral Chemicals, LLC.; (4)Kingston Chemistry. The properties of the chemical are: (1)ACD/LogP: 0.69; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 3; (4)#H bond donors: 2; (5)#Freely Rotating Bonds: 2; (6)Polar Surface Area: 80.04 Å2; (7)Index of Refraction: 1.718; (8)Molar Refractivity: 47.11 cm3; (9)Molar Volume: 119.4 cm3; (10)Polarizability: 18.67×10-24cm3; (11)Surface Tension: 72.3 dyne/cm; (12)Enthalpy of Vaporization: 57.11 kJ/mol; (13)Vapour Pressure: 0.000187 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
