| Identification | |
| Name: | N-Methyl-2-pyrrolidone |
| Synonyms: | 1-Methyl-2-pyrrolidinone;1-Methyl-5-pyrrolidinone; 1-Methylazacyclopentan-2-one; 1-Methylpyrrolidone;AgsolEx 1; M-Pyrol; Microposit 2001; N 0131; N-Methyl-2-ketopyrrolidine;N-Methyl-2-pyrrolidinone; N-Methyl-2-pyrrolidone; N-Methyl-a-pyrrolidinone; N-Methyl-a-pyrrolidone; N-Methyl-g-butyrolactam; N-Methylbutyrolactam; N-Methylpyrrolidone;NMP; NSC 4594; Pharmasolve; Pyrol M; SL 1332 |
| CAS: | 872-50-4 |
| EINECS: | 212-828-1 |
| Molecular Formula: | C5H9 N O |
| Molecular Weight: | 99.1311 |
| InChI: | InChI=1S/C5H9NO/c1-6-4-2-3-5(6)7/h2-4H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1268 3/PG 3 |
| Density: | 1.033 |
| Stability: | Stable, but decomposes upon exposure to light. Combustible. Incompatible with strong oxidizing agents, strong acids, reducing agents, bases. |
| Refractive index: | n20/D 1.479 |
| Appearance: | colourless or light yellow liquid with an amine odour |
| Report: |
Reported in EPA TSCA Inventory. |
| Sensitive: | Hygroscopic |
| Usage: | high purity grade for ICP-MS detection |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
