| Identification | |
| Name: | 4-(2,4-Dichlorophenyl)-1H-pyrrole-3-carbonitrile |
| Synonyms: | 4-(2,4-dichlorophenyl)-1h-pyrrole-3-carbonitrile |
| CAS: | 87388-06-5 |
| Molecular Formula: | C11H6Cl2N2 |
| Molecular Weight: | 237.09 |
| InChI: | InChI=1/C11H6Cl2N2/c12-8-1-2-9(11(13)3-8)10-6-15-5-7(10)4-14/h1-3,5-6,15H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.46 |
| Refractive index: | 1.656 |
| Specification: |
The 4-(2,4-Dichlorophenyl)-1H-pyrrole-3-carbonitrile with its cas register number is 87388-06-5. The Systematic name about this chemical is 4-(2,4-dichlorophenyl)-1H-pyrrole-3-carbonitrile. Physical properties about 4-(2,4-Dichlorophenyl)-1H-pyrrole-3-carbonitrile are: (1)ACD/LogP: 4.03; (2)ACD/LogD (pH 5.5): 4.02; (3)ACD/LogD (pH 7.4): 4.02; (4)ACD/BCF (pH 5.5): 674.37; (5)ACD/BCF (pH 7.4): 674.37; (6)ACD/KOC (pH 5.5): 3685.75; (7)ACD/KOC (pH 7.4): 3685.74; (8)#H bond acceptors: 2; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 1; (11)Polar Surface Area: 39.58Å2; (12)Index of Refraction: 1.656; (13)Molar Refractivity: 59.6 cm3; (14)Molar Volume: 162 cm3; (15)Polarizability: 23.62x10-24cm3; (16)Surface Tension: 65.2 dyne/cm; (17)Enthalpy of Vaporization: 68.61 kJ/mol; (18)Vapour Pressure: 1.28E-07 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
