| Identification | |
| Name: | Piperazine,1-(3-chloro-2-pyridinyl)- |
| Synonyms: | 1-(3-Chloropyridin-2-yl)piperazine;4-(3-Chloropyridin-2-yl)piperazine;N-(3-Chloropyridin-2-yl)piperazine; |
| CAS: | 87394-55-6 |
| Molecular Formula: | C9H12ClN3 |
| Molecular Weight: | 197.66 |
| InChI: | InChI=1/C9H12ClN3/c10-8-2-1-3-12-9(8)13-6-4-11-5-7-13/h1-3,11H,4-7H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.213 g/cm3 |
| Refractive index: | 1.561 |
| Specification: |
The 1-(3-Chloro-2-pyridyl)piperazine with the cas number 87394-55-6 is also called piperazine, 1-(3-chloro-2-pyridinyl)-. Its molecular formula is C9H12ClN3. The product category of this chemical is pharmacetical. This chemical is a kind of organics. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 1.40; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 7.4): 1.04; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 3; (6)ACD/KOC (pH 5.5): 1.1; (7)ACD/KOC (pH 7.4): 60.52; (8)#H bond acceptors: 3; (9)#H bond donors: 1; (10)#Freely Rotating Bonds: 1; (11)Polar Surface Area: 19.37 Å2; (12)Index of Refraction: 1.561; (13)Molar Refractivity: 52.79 cm3; (14)Molar Volume: 162.9 cm3; (15)Polarizability: 20.92×10-24cm3; (16)Surface Tension: 44.8 dyne/cm; (17)Enthalpy of Vaporization: 57.41 kJ/mol ; (18)Vapour Pressure: 0.000156 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
