| Identification | |
| Name: | 1,3-Dimethyluracil |
| Synonyms: | 1,3-dimethylpyrimidine-2,4-dione;2,4 (1H,3H)-Pyrimidinedione, 1, 3-dimethyl-;Uracil, 1,3-dimethyl-;2,4(1H,3H)-Pyrimidinedione, 1,3-dimethyl-;N,N-Dimethyluracil;Uracil, 1,3-dimethyl- (8CI);N1,N3-Dimethyluracil;1,3-Dimethyl Uracil;1,3-Dimethyl-uracil; |
| CAS: | 874-14-6 |
| EINECS: | 212-856-4 |
| Molecular Formula: | C6H8N2O2 |
| Molecular Weight: | 140.14 |
| InChI: | InChI=1/C6H8N2O2/c1-7-4-3-5(9)8(2)6(7)10/h3-4H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 84.3 ºC |
| Boiling Point: | 208.4 ºC |
| Density: | 1.22 g/cm3 |
| Refractive index: | 1.519 |
| Appearance: | white to light yellow needles |
| Specification: |
1,3-Dimethyluracil (CAS NO.874-14-6) is also named as N,N'-Dimethyluracil ; N1,N3-Dimethyluracil ; NSC 401858 ; 2,4(1H,3H)-Pyrimidinedione, 1,3-dimethyl- ; Uracil, 1,3-dimethyl- (8CI) . 1,3-Dimethyluracil (CAS NO.874-14-6) is white to light yellow needles. |
| Flash Point: | 84.3 ºC |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
