| Identification | |
| Name: | p-Toluoyl chloride |
| Synonyms: | 4-Methylbenzoyl chloride; para-toluoyl chloride; p-methylbenzoyl chloride |
| CAS: | 874-60-2 |
| EINECS: | 212-864-8 |
| Molecular Formula: | C8H7ClO |
| Molecular Weight: | 154.6 |
| InChI: | InChI=1/C8H7ClO/c1-6-2-4-7(5-3-6)8(9)10/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 8 |
| Density: | 1.16 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5525-1.5545 |
| Water Solubility: | Decomposes in water |
| Solubility: | Decomposes in water |
| Appearance: | Transparent liquid |
| Packinggroup: | II |
| HS Code: | 29163900 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. |
| Sensitive: | Moisture Sensitive |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
