| Identification |
| Name: | Benzene,1-methoxy-3,5-dimethyl- |
| Synonyms: | Anisole,3,5-dimethyl- (6CI,7CI,8CI);1-Methoxy-3,5-dimethylbenzene;5-Methoxy-1,3-dimethylbenzene;5-Methoxy-m-xylene; |
| CAS: | 874-63-5 |
| EINECS: | 212-865-3 |
| Molecular Formula: | C9H12O |
| Molecular Weight: | 136.19 |
| InChI: | InChI=1/C9H12O/c1-7-4-8(2)6-9(5-7)10-3/h4-6H,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 3271 |
| Melting Point: | -.2 |
| Density: | 0.963 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.5117-1.5137 |
| Solubility: | Insoluble |
| Appearance: | CLEAR COLOURLESS LIQUID |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| |
 |
