| Identification | |
| Name: | 3-Oxetanamine,3-methyl- |
| Synonyms: | 3-methyloxetan-3-amine;3-Oxetanamine, 3-methyl-; |
| CAS: | 874473-14-0 |
| Molecular Formula: | C4H9NO |
| Molecular Weight: | 87.07 |
| InChI: | InChI=1/C4H9NO/c1-4(5)2-6-3-4/h2-3,5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.99 g/cm3 |
| Refractive index: | 1.449 |
| Specification: |
3-Methyloxetan-3-amine with cas registry number of 874473-14-0 can also named as 3-Oxetanamine, 3-methyl- . 3-Methyloxetan-3-amine is also the IUPAC name for this compound. Its SMILES is CC1(COC1)N which is used to search this compound by stucture. As a commercial product, this compound can be obtained by custom synthesis. For example, Chemfuture Pharma Tech. (Jiangsu) Ltd. can provide this service. |
| Safety Data | |
 |
|
