| Identification | |
| Name: | 2,6-Dichloro-4-methylnicotinonitrile |
| Synonyms: | 3-cyano-4-methyl-2,6-dichloropyridine; 2,6-Dichloro-3-cyano-4-methylpyridine; 3-Cyano-2,6-Dichloro-4-Methyl Pyridine; |
| CAS: | 875-35-4 |
| EINECS: | 212-873-7 |
| Molecular Formula: | C7H4Cl2N2 |
| Molecular Weight: | 187.03 |
| InChI: | InChI=1/C7H4Cl2N2/c1-4-2-6(8)11-7(9)5(4)3-10/h2H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Density: | 1.42 g/cm3 |
| Refractive index: | 1.574 |
| Appearance: | Light yellow powder |
| Specification: |
3-Pyridinecarbonitrile,2,6-dichloro-4-methyl- , its cas register number is 875-35-4. It also can be called 2,6-Dichloro-4-methylnicotinonitrile . 3-Pyridinecarbonitrile,2,6-dichloro-4-methyl- (CAS NO.875-35-4) is irritating to eyes, respiratory system and skin and it is toxic if swallowed. What's more, it is risk of serious damage to the eyes and may cause sensitization by skin contact. |
| Packinggroup: | III |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
