| Identification | |
| Name: | 4-Bromo-2-nitroaniline |
| Synonyms: | 4-Bromo-o-nitroaniline;Benzenamine, 4-bromo-2-nitro-;p-Bromo-o-nitroaniline;4-bromo-2-nitro-aniline;4-Bromo-2-nitrobenzeneamine;Aniline, 4-bromo-2-nitro-;2-Nitro-4-bromoaniline;3-12-00-01670 (Beilstein Handbook Reference);4-Bromo-2-nitrobenzenamine;4-bromo-2-nitroaniline (IM OCS); |
| CAS: | 875-51-4 |
| Molecular Formula: | C6H5BrN2O2 |
| Molecular Weight: | 217.02 |
| InChI: | InChI=1/C6H5BrN2O2/c7-4-1-2-5(8)6(3-4)9(10)11/h1-3H,8H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.812 g/cm3 |
| Stability: | Stable at normal temperatures and pressures. |
| Refractive index: | 1.669 |
| Solubility: | 0.39 g/L (25 C) |
| Appearance: | yellow |
| Specification: |
4-Bromo-2-nitroaniline , its cas register number is 875-51-4. It also can be called 2-Nitro-4-bromoaniline ; 4-Bromo-2-nitrobenzeneamine ; 4-Bromo-o-nitroaniline ; Aniline, 4-bromo-2-nitro- ; Benzenamine, 4-bromo-2-nitro- ; p-Bromo-o-nitroaniline ; Aniline, 4-bromo-2-nitro- ; Benzenamine, 4-bromo-2-nitro- . |
| Storage Temperature: | Keep containers tightly closed. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
