| Identification | |
| Name: | Benzoic acid,4-(4-ethylcyclohexyl)-, trans- (9CI) |
| Synonyms: | benzoic acid, 4-(trans-4-ethylcyclohexyl)-; |
| CAS: | 87592-41-4 |
| Molecular Formula: | C15H20O2 |
| Molecular Weight: | 232.32 |
| InChI: | InChI=1/C9H16O2/c1-2-7-3-5-8(6-4-7)9(10)11/h7-8H,2-6H2,1H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 120°C |
| Boiling Point: | 252.5°C at 760 mmHg |
| Density: | 0.999g/cm3 |
| Refractive index: | 1.463 |
| Specification: |
4-trans(4-Ethyl cyclohexyl)benzoic acid ,its cas register number is 87592-41-4. It also can be called 4-(trans-4-Ethylcyclohexyl)benzoic acid ; and Benzoic acid, 4-(4-ethylcyclohexyl)- . |
| Flash Point: | 120°C |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data | |
 |
|
