| Identification | |
| Name: | Pyrazolo[1,5-a]pyridine-5-carboxylicacid, 3-chloro- |
| Synonyms: | 3-Chloropyrazolo[1,5-a]pyridine-5-carboxylic acid; |
| CAS: | 876379-80-5 |
| Molecular Formula: | C8H5ClN2O2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C8H5ClN2O2/c9-6-4-10-11-2-1-5(8(12)13)3-7(6)11/h1-4H,(H,12,13) |
| Molecular Structure: | ![(C8H5ClN2O2) 3-Chloropyrazolo[1,5-a]pyridine-5-carboxylic acid;](https://img1.guidechem.com/chem/e/dict/170/876379-80-5.jpg) |
| Properties | |
| Density: | 1.58 g/cm3 |
| Refractive index: | 1.696 |
| Specification: |
The 3-Chloropyrazolo[1,5-a]pyridine-5-carboxylic acid with the cas number 876379-80-5 is also called Pyrazolo[1,5-a]pyridine-5-carboxylicacid, 3-chloro-. Its molecular formula is C8H5ClN2O2. The product's category is CHIRAL CHEMICALS. It should be stored in dry and cool environment. The properties of the chemical are: (1)ACD/LogP: 1.95; (2)# of Rule of 5 Violations: 0; (3)#H bond acceptors: 4; (4)#H bond donors: 1; (5)#Freely Rotating Bonds: 1; (6)Polar Surface Area: 54.6 Å2; (7)Index of Refraction: 1.696; (8)Molar Refractivity: 47.62 cm3; (9)Molar Volume: 123.6 cm3; (10)Polarizability: 18.88×10-24cm3; (11)Surface Tension: 62.4 dyne/cm. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
