| Identification | |
| Name: | 3H-Phenoxazin-3-one,7-(pentyloxy)- |
| Synonyms: | 7-Pentoxyphenoxazone;7-Pentoxyresorufin; O-Pentylresorufin; Pentoxyresorufin |
| CAS: | 87687-03-4 |
| Molecular Formula: | C17H17 N O3 |
| Molecular Weight: | 283.32 |
| InChI: | InChI=1/C17H17NO3/c1-2-3-4-9-20-13-6-8-15-17(11-13)21-16-10-12(19)5-7-14(16)18-15/h5-8,10-11H,2-4,9H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 183.4°C |
| Boiling Point: | 423.6°C at 760 mmHg |
| Density: | 1.2g/cm3 |
| Refractive index: | 1.594 |
| Specification: |
Resorufin pentyl ether , its cas register number is 87687-03-4. It also can be called 7-(Pentyloxy)-3H-phenoxazin-3-one ; 7-Pentoxyphenoxazone ; 7-Pentoxyresorufin ; Pentoxyresorufin ; 3H-Phenoxazin-3-one, 7-(pentyloxy)- . |
| Flash Point: | 183.4°C |
| Storage Temperature: | 2-8°C |
| Usage: | Fluorimetric substrate. Dealkylation of pentoxyresorufin: A rapid sensitive assay for measuring induction of cytochrome(s) P-450. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
