| Identification | |
| Name: | 2-Propylpyrimidine-5-carbaldehyde |
| Synonyms: | ASISCHEM C63386;ASINEX-REAG BAS 11212160;2-PROPYL-PYRIMIDINE-5-CARBALDEHYDE;2-PROPYL-5-PYRIMIDINECARBOXALDEHYDE;5-Pyrimidinecarboxaldehyde, 2-propyl- |
| CAS: | 876890-38-9 |
| Molecular Formula: | C8H10N2O |
| Molecular Weight: | 150.18 |
| InChI: | InChI=1/C8H10N2O/c1-2-3-8-9-4-7(6-11)5-10-8/h4-6H,2-3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 105.1°C |
| Boiling Point: | 244.7°C at 760 mmHg |
| Density: | 1.097g/cm3 |
| Refractive index: | 1.546 |
| Specification: |
The 2-Propylpyrimidine-5-carbaldehyde with the cas number 876890-38-9 is also called 5-pyrimidinecarboxaldehyde, 2-propyl-. Its molecular formula is C8H10N2O. This chemical is irritant. When you are using this chemical, please be cautious about it. The properties of the chemical are: (1)ACD/LogP: 0.43; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.43; (4)ACD/LogD (pH 7.4): 0.43; (5)ACD/BCF (pH 5.5): 1.26; (6)ACD/BCF (pH 7.4): 1.26; (7)ACD/KOC (pH 5.5): 41.05; (8)ACD/KOC (pH 7.4): 41.05; (9)#H bond acceptors: 3; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 3; (12)Polar Surface Area: 42.85 Å2; (13)Index of Refraction: 1.546; (14)Molar Refractivity: 43.37 cm3; (15)Molar Volume: 136.8 cm3; (16)Polarizability: 17.19×10-24cm3; (17)Surface Tension: 46.2 dyne/cm; (18)Enthalpy of Vaporization: 48.18 kJ/mol; (19)Vapour Pressure: 0.0299 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Flash Point: | 105.1°C |
| Safety Data | |
 |
|
