Identification |
Name: | 2-Propenoic acid, 2-methyl-, polymer with isodecyl 2-methyl-2-propenoate |
Synonyms: | Isodecyl methacrylate, methacrylic acid polymer;AC1O595G;8-methylnonyl 2-methylprop-2-enoate; 2-methylprop-2-enoic acid;2-Propenoic acid, 2-methyl-, polymer with isodecyl 2-methyl-2-propenoate;61987-71-1;87709-67-9 |
CAS: | 87709-67-9 |
Molecular Formula: | C18H32O4 |
Molecular Weight: | 312.44428 |
InChI: | InChI=1S/C14H26O2.C4H6O2/c1-12(2)10-8-6-5-7-9-11-16-14(15)13(3)4;1-3(2)4(5)6/h12H,3,5-11H2,1-2,4H3;1H2,2H3,(H,5,6) |
Molecular Structure: |
![(C18H32O4) Isodecyl methacrylate, methacrylic acid polymer;AC1O595G;8-methylnonyl 2-methylprop-2-enoate; 2-meth...](https://img1.guidechem.com/structure/image/87709-67-9.png) |
Properties |
Flash Point: | 112.1°C |
Boiling Point: | 283.9°Cat760mmHg |
Density: | g/cm3 |
Flash Point: | 112.1°C |
Safety Data |
|
![](/images/detail_15.png) |